C29H28Cl2FN3O4 — CID 118458374
CID 118458374 (PubChem CID 118458374) has the molecular formula C29H28Cl2FN3O4 and a molecular weight of 572.46 g/mol.
| Compound Name | CID 118458374 |
|---|---|
| PubChem CID | 118458374 |
| Molecular Formula | C29H28Cl2FN3O4 |
| Molecular Weight | 572.46 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | — |
| SMILES | O=C(NC12CC(C(=O)O)(C1)C2)[C@@H]1NC2(CCCCC2)[C@@]2(C(=O)Nc3cc(Cl)ccc32)[C@H]1c1cccc(Cl)c1F |
| InChI | InChI=1S/C29H28Cl2FN3O4/c30-15-7-8-17-19(11-15)33-24(37)29(17)20(16-5-4-6-18(31)21(16)32)22(34-28(29)9-2-1-3-10-28)23(36)35-27-12-26(13-27,14-27)25(38)39/h4-8,11,20,22,34H,1-3,9-10,12-14H2,(H,33,37)(H,35,36)(H,38,39)/t20-,22+,26?,27?,29+/m0/s1 |
| InChIKey | NLOAAQVEPPPINN-XYSUXJPUSA-N |
| XLogP | 4.90 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.46 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |