C9H12O6 — CID 11845883
methyl 2-[(4R)-5-oxo-4-(3-oxopropyl)-1,3-dioxolan-4-yl]acetate (PubChem CID 11845883) has the molecular formula C9H12O6 and a molecular weight of 216.19 g/mol. Its IUPAC name is methyl 2-[(4R)-5-oxo-4-(3-oxopropyl)-1,3-dioxolan-4-yl]acetate.
| Compound Name | methyl 2-[(4R)-5-oxo-4-(3-oxopropyl)-1,3-dioxolan-4-yl]acetate |
|---|---|
| PubChem CID | 11845883 |
| Molecular Formula | C9H12O6 |
| Molecular Weight | 216.19 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | methyl 2-[(4R)-5-oxo-4-(3-oxopropyl)-1,3-dioxolan-4-yl]acetate |
| SMILES | COC(=O)C[C@@]1(CCC=O)OCOC1=O |
| InChI | InChI=1S/C9H12O6/c1-13-7(11)5-9(3-2-4-10)8(12)14-6-15-9/h4H,2-3,5-6H2,1H3/t9-/m1/s1 |
| InChIKey | NLGUNCWRPYONKJ-SECBINFHSA-N |
| XLogP | -0.20 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.19 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|