C20H26N8O — CID 118462048
4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]-1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-11-one (PubChem CID 118462048) has the molecular formula C20H26N8O and a molecular weight of 394.48 g/mol. Its IUPAC name is 4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]-1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-11-one.
| Compound Name | 4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]-1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-11-one |
|---|---|
| PubChem CID | 118462048 |
| Molecular Formula | C20H26N8O |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.22 |
| IUPAC Name | 4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]-1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-trien-11-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(n3)N3CCNC(=O)C3CC4)nc2)CC1 |
| InChI | InChI=1S/C20H26N8O/c1-26-8-10-27(11-9-26)15-3-5-17(22-13-15)24-20-23-12-14-2-4-16-19(29)21-6-7-28(16)18(14)25-20/h3,5,12-13,16H,2,4,6-11H2,1H3,(H,21,29)(H,22,23,24,25) |
| InChIKey | BOIQULYPALUTRL-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |