C25H34N8O — CID 123476117
4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-14,1'-cyclohexane]-8-one (PubChem CID 123476117) has the molecular formula C25H34N8O and a molecular weight of 462.60 g/mol. Its IUPAC name is 4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-14,1'-cyclohexane]-8-one.
| Compound Name | 4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-14,1'-cyclohexane]-8-one |
|---|---|
| PubChem CID | 123476117 |
| Molecular Formula | C25H34N8O |
| Molecular Weight | 462.60 g/mol |
| Exact Mass | 462.29 |
| IUPAC Name | 4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6-triene-14,1'-cyclohexane]-8-one |
| SMILES | CN1CCN(c2ccc(Nc3ncc4c(n3)N3C(CNCC35CCCCC5)CC4=O)nc2)CC1 |
| InChI | InChI=1S/C25H34N8O/c1-31-9-11-32(12-10-31)18-5-6-22(27-15-18)29-24-28-16-20-21(34)13-19-14-26-17-25(7-3-2-4-8-25)33(19)23(20)30-24/h5-6,15-16,19,26H,2-4,7-14,17H2,1H3,(H,27,28,29,30) |
| InChIKey | GQMSRSKKGVXDSX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.60 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |