C32H42N8O — CID 123698174
4-[[5-[4-(3,3-dimethylbutyl)-3-ethynylpiperazin-1-yl]-2-pyridinyl]amino]spiro[1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6,8-tetraene-14,1'-cyclohexane]-11-one (PubChem CID 123698174) has the molecular formula C32H42N8O and a molecular weight of 554.74 g/mol. Its IUPAC name is 4-[[5-[4-(3,3-dimethylbutyl)-3-ethynylpiperazin-1-yl]-2-pyridinyl]amino]spiro[1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6,8-tetraene-14,1'-cyclohexane]-11-one.
| Compound Name | 4-[[5-[4-(3,3-dimethylbutyl)-3-ethynylpiperazin-1-yl]-2-pyridinyl]amino]spiro[1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6,8-tetraene-14,1'-cyclohexane]-11-one |
|---|---|
| PubChem CID | 123698174 |
| Molecular Formula | C32H42N8O |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.35 |
| IUPAC Name | 4-[[5-[4-(3,3-dimethylbutyl)-3-ethynylpiperazin-1-yl]-2-pyridinyl]amino]spiro[1,3,5,12-tetrazatricyclo[8.4.0.02,7]tetradeca-2,4,6,8-tetraene-14,1'-cyclohexane]-11-one |
| SMILES | C#CC1CN(c2ccc(Nc3ncc4c(n3)N3C(C=C4)C(=O)NCC34CCCCC4)nc2)CCN1CCC(C)(C)C |
| InChI | InChI=1S/C32H42N8O/c1-5-24-21-39(18-17-38(24)16-15-31(2,3)4)25-10-12-27(33-20-25)36-30-34-19-23-9-11-26-29(41)35-22-32(13-7-6-8-14-32)40(26)28(23)37-30/h1,9-12,19-20,24,26H,6-8,13-18,21-22H2,2-4H3,(H,35,41)(H,33,34,36,37) |
| InChIKey | WUYRHLYOJNEYGY-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|