C24H32N8O — CID 155818189
4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-3,5,8-triene-13,1'-cyclohexane]-10-one (PubChem CID 155818189) has the molecular formula C24H32N8O and a molecular weight of 448.58 g/mol. Its IUPAC name is 4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-3,5,8-triene-13,1'-cyclohexane]-10-one.
| Compound Name | 4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-3,5,8-triene-13,1'-cyclohexane]-10-one |
|---|---|
| PubChem CID | 155818189 |
| Molecular Formula | C24H32N8O |
| Molecular Weight | 448.58 g/mol |
| Exact Mass | 448.27 |
| IUPAC Name | 4-[[5-(4-methylpiperazin-1-yl)-2-pyridinyl]amino]spiro[1,3,5,11-tetrazatricyclo[7.4.0.02,7]trideca-3,5,8-triene-13,1'-cyclohexane]-10-one |
| SMILES | CN1CCN(c2ccc(NC3=NC4C(C=N3)C=C3C(=O)NCC5(CCCCC5)N34)nc2)CC1 |
| InChI | InChI=1S/C24H32N8O/c1-30-9-11-31(12-10-30)18-5-6-20(25-15-18)28-23-26-14-17-13-19-22(33)27-16-24(7-3-2-4-8-24)32(19)21(17)29-23/h5-6,13-15,17,21H,2-4,7-12,16H2,1H3,(H,27,33)(H,25,28,29) |
| InChIKey | KKWXIJCISRVQGE-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 88.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.58 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |