C28H22F3N5O2 — CID 118463834
N-(3-imidazol-1-ylpropyl)-2-phenyl-3-[3-(trifluoromethoxy)phenyl]quinoxaline-6-carboxamide (PubChem CID 118463834) has the molecular formula C28H22F3N5O2 and a molecular weight of 517.51 g/mol. Its IUPAC name is N-(3-imidazol-1-ylpropyl)-2-phenyl-3-[3-(trifluoromethoxy)phenyl]quinoxaline-6-carboxamide.
| Compound Name | N-(3-imidazol-1-ylpropyl)-2-phenyl-3-[3-(trifluoromethoxy)phenyl]quinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 118463834 |
| Molecular Formula | C28H22F3N5O2 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | N-(3-imidazol-1-ylpropyl)-2-phenyl-3-[3-(trifluoromethoxy)phenyl]quinoxaline-6-carboxamide |
| SMILES | O=C(NCCCn1ccnc1)c1ccc2nc(-c3ccccc3)c(-c3cccc(OC(F)(F)F)c3)nc2c1 |
| InChI | InChI=1S/C28H22F3N5O2/c29-28(30,31)38-22-9-4-8-20(16-22)26-25(19-6-2-1-3-7-19)34-23-11-10-21(17-24(23)35-26)27(37)33-12-5-14-36-15-13-32-18-36/h1-4,6-11,13,15-18H,5,12,14H2,(H,33,37) |
| InChIKey | PQLYGHLFTQLBBY-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|