C7H10F2N2O2S — CID 118464148
3-(difluoromethylsulfonyl)-5-ethyl-1-methylpyrazole (PubChem CID 118464148) has the molecular formula C7H10F2N2O2S and a molecular weight of 224.23 g/mol. Its IUPAC name is 3-(difluoromethylsulfonyl)-5-ethyl-1-methylpyrazole.
| Compound Name | 3-(difluoromethylsulfonyl)-5-ethyl-1-methylpyrazole |
|---|---|
| PubChem CID | 118464148 |
| Molecular Formula | C7H10F2N2O2S |
| Molecular Weight | 224.23 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 3-(difluoromethylsulfonyl)-5-ethyl-1-methylpyrazole |
| SMILES | CCc1cc(S(=O)(=O)C(F)F)nn1C |
| InChI | InChI=1S/C7H10F2N2O2S/c1-3-5-4-6(10-11(5)2)14(12,13)7(8)9/h4,7H,3H2,1-2H3 |
| InChIKey | OZYCIDKEZDBXBO-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.23 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |