C27H24INO4 — CID 118464371
1-[[4-[2-(1-iodobutoxycarbonyl)phenyl]phenyl]methyl]indole-5-carboxylic acid (PubChem CID 118464371) has the molecular formula C27H24INO4 and a molecular weight of 553.40 g/mol. Its IUPAC name is 1-[[4-[2-(1-iodobutoxycarbonyl)phenyl]phenyl]methyl]indole-5-carboxylic acid.
| Compound Name | 1-[[4-[2-(1-iodobutoxycarbonyl)phenyl]phenyl]methyl]indole-5-carboxylic acid |
|---|---|
| PubChem CID | 118464371 |
| Molecular Formula | C27H24INO4 |
| Molecular Weight | 553.40 g/mol |
| Exact Mass | 553.08 |
| IUPAC Name | 1-[[4-[2-(1-iodobutoxycarbonyl)phenyl]phenyl]methyl]indole-5-carboxylic acid |
| SMILES | CCCC(I)OC(=O)c1ccccc1-c1ccc(Cn2ccc3cc(C(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C27H24INO4/c1-2-5-25(28)33-27(32)23-7-4-3-6-22(23)19-10-8-18(9-11-19)17-29-15-14-20-16-21(26(30)31)12-13-24(20)29/h3-4,6-16,25H,2,5,17H2,1H3,(H,30,31) |
| InChIKey | PDWBIYUPSYDCHA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.40 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|