C28H27NO4 — CID 126554096
1-[[4-(2-butoxycarbonylphenyl)phenyl]methyl]-3-methylindole-5-carboxylic acid (PubChem CID 126554096) has the molecular formula C28H27NO4 and a molecular weight of 441.53 g/mol. Its IUPAC name is 1-[[4-(2-butoxycarbonylphenyl)phenyl]methyl]-3-methylindole-5-carboxylic acid.
| Compound Name | 1-[[4-(2-butoxycarbonylphenyl)phenyl]methyl]-3-methylindole-5-carboxylic acid |
|---|---|
| PubChem CID | 126554096 |
| Molecular Formula | C28H27NO4 |
| Molecular Weight | 441.53 g/mol |
| Exact Mass | 441.19 |
| IUPAC Name | 1-[[4-(2-butoxycarbonylphenyl)phenyl]methyl]-3-methylindole-5-carboxylic acid |
| SMILES | CCCCOC(=O)c1ccccc1-c1ccc(Cn2cc(C)c3cc(C(=O)O)ccc32)cc1 |
| InChI | InChI=1S/C28H27NO4/c1-3-4-15-33-28(32)24-8-6-5-7-23(24)21-11-9-20(10-12-21)18-29-17-19(2)25-16-22(27(30)31)13-14-26(25)29/h5-14,16-17H,3-4,15,18H2,1-2H3,(H,30,31) |
| InChIKey | AAYGZVXZMXDCOK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.53 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|