C19H36N4 — CID 118465702
1-N'-[2-amino-1-(1-prop-2-enylpyrrolidin-3-yl)ethyl]-1-N-[(4R)-4-methylcyclohexen-1-yl]propane-1,1-diamine (PubChem CID 118465702) has the molecular formula C19H36N4 and a molecular weight of 320.52 g/mol. Its IUPAC name is 1-N'-[2-amino-1-(1-prop-2-enylpyrrolidin-3-yl)ethyl]-1-N-[(4R)-4-methylcyclohexen-1-yl]propane-1,1-diamine.
| Compound Name | 1-N'-[2-amino-1-(1-prop-2-enylpyrrolidin-3-yl)ethyl]-1-N-[(4R)-4-methylcyclohexen-1-yl]propane-1,1-diamine |
|---|---|
| PubChem CID | 118465702 |
| Molecular Formula | C19H36N4 |
| Molecular Weight | 320.52 g/mol |
| Exact Mass | 320.29 |
| IUPAC Name | 1-N'-[2-amino-1-(1-prop-2-enylpyrrolidin-3-yl)ethyl]-1-N-[(4R)-4-methylcyclohexen-1-yl]propane-1,1-diamine |
| SMILES | C=CCN1CCC(C(CN)NC(CC)NC2=CC[C@H](C)CC2)C1 |
| InChI | InChI=1S/C19H36N4/c1-4-11-23-12-10-16(14-23)18(13-20)22-19(5-2)21-17-8-6-15(3)7-9-17/h4,8,15-16,18-19,21-22H,1,5-7,9-14,20H2,2-3H3/t15-,16?,18?,19?/m0/s1 |
| InChIKey | WCQADRNYSBTFOS-HXQJQUPVSA-N |
| XLogP | 2.44 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.52 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|