C29H49N3 — CID 155358670
(6Z)-N-ethyl-N-[4-[(4E,5E)-4-ethylidene-5-prop-2-enylideneimidazolidin-1-yl]butyl]-4,9-dimethyl-6-prop-2-enylidenedec-8-en-1-amine (PubChem CID 155358670) has the molecular formula C29H49N3 and a molecular weight of 439.73 g/mol. Its IUPAC name is (6Z)-N-ethyl-N-[4-[(4E,5E)-4-ethylidene-5-prop-2-enylideneimidazolidin-1-yl]butyl]-4,9-dimethyl-6-prop-2-enylidenedec-8-en-1-amine.
| Compound Name | (6Z)-N-ethyl-N-[4-[(4E,5E)-4-ethylidene-5-prop-2-enylideneimidazolidin-1-yl]butyl]-4,9-dimethyl-6-prop-2-enylidenedec-8-en-1-amine |
|---|---|
| PubChem CID | 155358670 |
| Molecular Formula | C29H49N3 |
| Molecular Weight | 439.73 g/mol |
| Exact Mass | 439.39 |
| IUPAC Name | (6Z)-N-ethyl-N-[4-[(4E,5E)-4-ethylidene-5-prop-2-enylideneimidazolidin-1-yl]butyl]-4,9-dimethyl-6-prop-2-enylidenedec-8-en-1-amine |
| SMILES | C=C/C=C(\CC=C(C)C)CC(C)CCCN(CC)CCCCN1CNC(=C/C)/C1=C\C=C |
| InChI | InChI=1S/C29H49N3/c1-8-15-27(19-18-25(5)6)23-26(7)17-14-21-31(11-4)20-12-13-22-32-24-30-28(10-3)29(32)16-9-2/h8-10,15-16,18,26,30H,1-2,11-14,17,19-24H2,3-7H3/b27-15+,28-10+,29-16+ |
| InChIKey | ASTKMZQQLMQSNX-IJIZUFTFSA-N |
| XLogP | 7.20 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.73 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|