C22H35N3 — CID 130374598
(3E,6E,8Z)-7-but-1-en-2-yl-3-ethyl-4-imidazolidin-1-yl-N,N-dimethyl-5-methylidenedeca-1,3,6,8-tetraen-2-amine (PubChem CID 130374598) has the molecular formula C22H35N3 and a molecular weight of 341.54 g/mol. Its IUPAC name is (3E,6E,8Z)-7-but-1-en-2-yl-3-ethyl-4-imidazolidin-1-yl-N,N-dimethyl-5-methylidenedeca-1,3,6,8-tetraen-2-amine.
| Compound Name | (3E,6E,8Z)-7-but-1-en-2-yl-3-ethyl-4-imidazolidin-1-yl-N,N-dimethyl-5-methylidenedeca-1,3,6,8-tetraen-2-amine |
|---|---|
| PubChem CID | 130374598 |
| Molecular Formula | C22H35N3 |
| Molecular Weight | 341.54 g/mol |
| Exact Mass | 341.28 |
| IUPAC Name | (3E,6E,8Z)-7-but-1-en-2-yl-3-ethyl-4-imidazolidin-1-yl-N,N-dimethyl-5-methylidenedeca-1,3,6,8-tetraen-2-amine |
| SMILES | C=C(/C=C(\C=C/C)C(=C)CC)/C(=C(\CC)C(=C)N(C)C)N1CCNC1 |
| InChI | InChI=1S/C22H35N3/c1-9-12-20(17(4)10-2)15-18(5)22(25-14-13-23-16-25)21(11-3)19(6)24(7)8/h9,12,15,23H,4-6,10-11,13-14,16H2,1-3,7-8H3/b12-9-,20-15+,22-21+ |
| InChIKey | KMFSOKOFANMANN-UBBLMBICSA-N |
| XLogP | 4.61 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.54 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|