C31H47N3 — CID 130216285
2-[(2E,4E)-3,5-dimethyl-8-(5-methylcyclohepta-1,4,6-trien-1-yl)undeca-2,4-dien-2-yl]-3-methyl-5-prop-1-en-2-yl-2,4,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine (PubChem CID 130216285) has the molecular formula C31H47N3 and a molecular weight of 461.74 g/mol. Its IUPAC name is 2-[(2E,4E)-3,5-dimethyl-8-(5-methylcyclohepta-1,4,6-trien-1-yl)undeca-2,4-dien-2-yl]-3-methyl-5-prop-1-en-2-yl-2,4,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine.
| Compound Name | 2-[(2E,4E)-3,5-dimethyl-8-(5-methylcyclohepta-1,4,6-trien-1-yl)undeca-2,4-dien-2-yl]-3-methyl-5-prop-1-en-2-yl-2,4,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine |
|---|---|
| PubChem CID | 130216285 |
| Molecular Formula | C31H47N3 |
| Molecular Weight | 461.74 g/mol |
| Exact Mass | 461.38 |
| IUPAC Name | 2-[(2E,4E)-3,5-dimethyl-8-(5-methylcyclohepta-1,4,6-trien-1-yl)undeca-2,4-dien-2-yl]-3-methyl-5-prop-1-en-2-yl-2,4,6,7-tetrahydro-1H-imidazo[4,5-c]pyridine |
| SMILES | C=C(C)N1CCC2=C(C1)N(C)C(/C(C)=C(C)/C=C(\C)CCC(CCC)C1=CCC=C(C)C=C1)N2 |
| InChI | InChI=1S/C31H47N3/c1-9-11-27(28-13-10-12-23(4)14-16-28)17-15-24(5)20-25(6)26(7)31-32-29-18-19-34(22(2)3)21-30(29)33(31)8/h12-14,16,20,27,31-32H,2,9-11,15,17-19,21H2,1,3-8H3/b24-20+,26-25+ |
| InChIKey | QNRRVVHJESYYBF-AFYGLASUSA-N |
| XLogP | 7.61 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.74 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|