C21H35N3 — CID 170091124
3-N-methyl-2-N-[1-[methyl-[4-methyl-4-(3-methylbut-3-enyl)cyclohexa-1,5-dien-1-yl]amino]prop-2-enyl]but-1-ene-2,3-diamine (PubChem CID 170091124) has the molecular formula C21H35N3 and a molecular weight of 329.53 g/mol. Its IUPAC name is 3-N-methyl-2-N-[1-[methyl-[4-methyl-4-(3-methylbut-3-enyl)cyclohexa-1,5-dien-1-yl]amino]prop-2-enyl]but-1-ene-2,3-diamine.
| Compound Name | 3-N-methyl-2-N-[1-[methyl-[4-methyl-4-(3-methylbut-3-enyl)cyclohexa-1,5-dien-1-yl]amino]prop-2-enyl]but-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 170091124 |
| Molecular Formula | C21H35N3 |
| Molecular Weight | 329.53 g/mol |
| Exact Mass | 329.28 |
| IUPAC Name | 3-N-methyl-2-N-[1-[methyl-[4-methyl-4-(3-methylbut-3-enyl)cyclohexa-1,5-dien-1-yl]amino]prop-2-enyl]but-1-ene-2,3-diamine |
| SMILES | C=CC(NC(=C)C(C)NC)N(C)C1=CCC(C)(CCC(=C)C)C=C1 |
| InChI | InChI=1S/C21H35N3/c1-9-20(23-18(5)17(4)22-7)24(8)19-11-14-21(6,15-12-19)13-10-16(2)3/h9,11-12,14,17,20,22-23H,1-2,5,10,13,15H2,3-4,6-8H3 |
| InChIKey | AGZRARMRFYSUMH-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 27.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.53 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|