C26H40N4 — CID 142855680
(3Z)-2-N-[[4-(2-cyclohepta-1,3,6-trien-1-ylethyl)piperidin-1-yl]methyl]-3-N-[(2Z,4Z)-hexa-2,4-dienyl]penta-1,3-diene-2,3,4-triamine (PubChem CID 142855680) has the molecular formula C26H40N4 and a molecular weight of 408.63 g/mol. Its IUPAC name is (3Z)-2-N-[[4-(2-cyclohepta-1,3,6-trien-1-ylethyl)piperidin-1-yl]methyl]-3-N-[(2Z,4Z)-hexa-2,4-dienyl]penta-1,3-diene-2,3,4-triamine.
| Compound Name | (3Z)-2-N-[[4-(2-cyclohepta-1,3,6-trien-1-ylethyl)piperidin-1-yl]methyl]-3-N-[(2Z,4Z)-hexa-2,4-dienyl]penta-1,3-diene-2,3,4-triamine |
|---|---|
| PubChem CID | 142855680 |
| Molecular Formula | C26H40N4 |
| Molecular Weight | 408.63 g/mol |
| Exact Mass | 408.33 |
| IUPAC Name | (3Z)-2-N-[[4-(2-cyclohepta-1,3,6-trien-1-ylethyl)piperidin-1-yl]methyl]-3-N-[(2Z,4Z)-hexa-2,4-dienyl]penta-1,3-diene-2,3,4-triamine |
| SMILES | C=C(NCN1CCC(CCC2=CC=CCC=C2)CC1)/C(NC/C=C\C=C/C)=C(\C)N |
| InChI | InChI=1S/C26H40N4/c1-4-5-6-11-18-28-26(22(2)27)23(3)29-21-30-19-16-25(17-20-30)15-14-24-12-9-7-8-10-13-24/h4-7,9-13,25,28-29H,3,8,14-21,27H2,1-2H3/b5-4-,11-6-,26-22- |
| InChIKey | BVRKKYHTUGCFMU-BDHKMXCHSA-N |
| XLogP | 4.89 |
| TPSA | 53.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.63 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|