C20H30FN4+ — CID 156732508
[(3S)-1-[2-amino-6-(2-fluoro-6-methylcyclohex-3-en-1-yl)-5,6-dihydro-1H-indol-4-yl]piperidin-3-yl]azanium (PubChem CID 156732508) has the molecular formula C20H30FN4+ and a molecular weight of 345.49 g/mol. Its IUPAC name is [(3S)-1-[2-amino-6-(2-fluoro-6-methylcyclohex-3-en-1-yl)-5,6-dihydro-1H-indol-4-yl]piperidin-3-yl]azanium.
| Compound Name | [(3S)-1-[2-amino-6-(2-fluoro-6-methylcyclohex-3-en-1-yl)-5,6-dihydro-1H-indol-4-yl]piperidin-3-yl]azanium |
|---|---|
| PubChem CID | 156732508 |
| Molecular Formula | C20H30FN4+ |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | [(3S)-1-[2-amino-6-(2-fluoro-6-methylcyclohex-3-en-1-yl)-5,6-dihydro-1H-indol-4-yl]piperidin-3-yl]azanium |
| SMILES | CC1CC=CC(F)C1C1C=c2[nH]c(N)cc2=C(N2CCC[C@H]([NH3+])C2)C1 |
| InChI | InChI=1S/C20H29FN4/c1-12-4-2-6-16(21)20(12)13-8-17-15(10-19(23)24-17)18(9-13)25-7-3-5-14(22)11-25/h2,6,8,10,12-14,16,20,24H,3-5,7,9,11,22-23H2,1H3/p+1/t12?,13?,14-,16?,20?/m0/s1 |
| InChIKey | XRJFZQPKCHUQKI-CEIAKLMWSA-O |
| XLogP | 0.76 |
| TPSA | 72.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|