C29H42N4 — CID 130374478
1-N'-[(3Z)-3-[[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]-(6-methylcyclohexa-1,3-dien-1-yl)methylidene]penta-1,4-dien-2-yl]-1-N,1-N,1-N'-trimethylethene-1,1-diamine (PubChem CID 130374478) has the molecular formula C29H42N4 and a molecular weight of 446.68 g/mol. Its IUPAC name is 1-N'-[(3Z)-3-[[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]-(6-methylcyclohexa-1,3-dien-1-yl)methylidene]penta-1,4-dien-2-yl]-1-N,1-N,1-N'-trimethylethene-1,1-diamine.
| Compound Name | 1-N'-[(3Z)-3-[[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]-(6-methylcyclohexa-1,3-dien-1-yl)methylidene]penta-1,4-dien-2-yl]-1-N,1-N,1-N'-trimethylethene-1,1-diamine |
|---|---|
| PubChem CID | 130374478 |
| Molecular Formula | C29H42N4 |
| Molecular Weight | 446.68 g/mol |
| Exact Mass | 446.34 |
| IUPAC Name | 1-N'-[(3Z)-3-[[3-[(3E,5Z)-hepta-1,3,5-trien-3-yl]piperazin-1-yl]-(6-methylcyclohexa-1,3-dien-1-yl)methylidene]penta-1,4-dien-2-yl]-1-N,1-N,1-N'-trimethylethene-1,1-diamine |
| SMILES | C=C/C(C(=C)N(C)C(=C)N(C)C)=C(\C1=CC=CCC1C)N1CCNC(/C(C=C)=C/C=C\C)C1 |
| InChI | InChI=1S/C29H42N4/c1-10-13-17-25(11-2)28-21-33(20-19-30-28)29(27-18-15-14-16-22(27)4)26(12-3)23(5)32(9)24(6)31(7)8/h10-15,17-18,22,28,30H,2-3,5-6,16,19-21H2,1,4,7-9H3/b13-10-,25-17+,29-26- |
| InChIKey | FJTGWPVIQUFBDJ-HDQDYWKOSA-N |
| XLogP | 5.39 |
| TPSA | 21.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.68 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|