C11H15N5O5 — CID 118466031
1-[(2R,4S,5S)-4-azido-4,5-bis(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 118466031) has the molecular formula C11H15N5O5 and a molecular weight of 297.27 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-azido-4,5-bis(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-azido-4,5-bis(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 118466031 |
| Molecular Formula | C11H15N5O5 |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | 1-[(2R,4S,5S)-4-azido-4,5-bis(hydroxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@@](CO)(N=[N+]=[N-])[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N5O5/c1-6-3-16(10(20)13-9(6)19)8-2-11(5-18,14-15-12)7(4-17)21-8/h3,7-8,17-18H,2,4-5H2,1H3,(H,13,19,20)/t7-,8-,11+/m1/s1 |
| InChIKey | WJARIFZSFZMBOZ-XLDPMVHQSA-N |
| XLogP | -0.83 |
| TPSA | 153.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|