C11H15N5O7S — CID 22845789
1-[(2R,4S,5S)-4-azido-4-hydroxy-5-[hydroxy(methylsulfonyl)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 22845789) has the molecular formula C11H15N5O7S and a molecular weight of 361.34 g/mol. Its IUPAC name is 1-[(2R,4S,5S)-4-azido-4-hydroxy-5-[hydroxy(methylsulfonyl)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4S,5S)-4-azido-4-hydroxy-5-[hydroxy(methylsulfonyl)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22845789 |
| Molecular Formula | C11H15N5O7S |
| Molecular Weight | 361.34 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 1-[(2R,4S,5S)-4-azido-4-hydroxy-5-[hydroxy(methylsulfonyl)methyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2C[C@@](O)(N=[N+]=[N-])[C@@H](C(O)S(C)(=O)=O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15N5O7S/c1-5-4-16(10(19)13-8(5)17)6-3-11(20,14-15-12)7(23-6)9(18)24(2,21)22/h4,6-7,9,18,20H,3H2,1-2H3,(H,13,17,19)/t6-,7-,9?,11+/m1/s1 |
| InChIKey | KIURQZGUXWVKJW-GBXYMPPMSA-N |
| XLogP | -1.51 |
| TPSA | 187.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.34 |
| LogP ≤ 5 | -1.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|