C11H16N5O6P — CID 101145429
[(2S,3S,5R)-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methylphosphonic acid (PubChem CID 101145429) has the molecular formula C11H16N5O6P and a molecular weight of 345.25 g/mol. Its IUPAC name is [(2S,3S,5R)-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methylphosphonic acid.
| Compound Name | [(2S,3S,5R)-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 101145429 |
| Molecular Formula | C11H16N5O6P |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | [(2S,3S,5R)-2-(azidomethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methylphosphonic acid |
| SMILES | Cc1cn([C@H]2C[C@H](C[P+]([O-])(O)O)[C@@H](CN=[N+]=[N-])O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H16N5O6P/c1-6-4-16(11(18)14-10(6)17)9-2-7(5-23(19,20)21)8(22-9)3-13-15-12/h4,7-9H,2-3,5H2,1H3,(H,14,17,18)(H2,19,20,21)/t7-,8-,9-/m1/s1 |
| InChIKey | IXBSWMDOVLDKRY-IWSPIJDZSA-N |
| XLogP | -0.83 |
| TPSA | 176.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|