C11H17N2O7P — CID 14859434
[(2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methylphosphonic acid (PubChem CID 14859434) has the molecular formula C11H17N2O7P and a molecular weight of 320.24 g/mol. Its IUPAC name is [(2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methylphosphonic acid.
| Compound Name | [(2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methylphosphonic acid |
|---|---|
| PubChem CID | 14859434 |
| Molecular Formula | C11H17N2O7P |
| Molecular Weight | 320.24 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [(2S,3S,5R)-2-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-3-yl]methylphosphonic acid |
| SMILES | Cc1cn([C@H]2C[C@H](CP(=O)(O)O)[C@@H](CO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N2O7P/c1-6-3-13(11(16)12-10(6)15)9-2-7(5-21(17,18)19)8(4-14)20-9/h3,7-9,14H,2,4-5H2,1H3,(H,12,15,16)(H2,17,18,19)/t7-,8-,9-/m1/s1 |
| InChIKey | HQWMRNSFBVDKQO-IWSPIJDZSA-N |
| XLogP | -1.08 |
| TPSA | 141.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.24 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|