C20H25N10O14P — CID 56636931
bis[[(2S,3S,5R)-3-azido-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl] hydrogen phosphate (PubChem CID 56636931) has the molecular formula C20H25N10O14P and a molecular weight of 660.45 g/mol. Its IUPAC name is bis[[(2S,3S,5R)-3-azido-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl] hydrogen phosphate.
| Compound Name | bis[[(2S,3S,5R)-3-azido-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl] hydrogen phosphate |
|---|---|
| PubChem CID | 56636931 |
| Molecular Formula | C20H25N10O14P |
| Molecular Weight | 660.45 g/mol |
| Exact Mass | 660.13 |
| IUPAC Name | bis[[(2S,3S,5R)-3-azido-3-hydroxy-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]-hydroxymethyl] hydrogen phosphate |
| SMILES | Cc1cn([C@H]2C[C@@](O)(N=[N+]=[N-])[C@@H](C(O)OP(=O)(O)OC(O)[C@H]3O[C@@H](n4cc(C)c(=O)[nH]c4=O)C[C@@]3(O)N=[N+]=[N-])O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H25N10O14P/c1-7-5-29(17(35)23-13(7)31)9-3-19(37,25-27-21)11(41-9)15(33)43-45(39,40)44-16(34)12-20(38,26-28-22)4-10(42-12)30-6-8(2)14(32)24-18(30)36/h5-6,9-12,15-16,33-34,37-38H,3-4H2,1-2H3,(H,39,40)(H,23,31,35)(H,24,32,36)/t9-,10-,11-,12-,15?,16?,19+,20+/m1/s1 |
| InChIKey | GDODFXRJWBBQFC-HEKSXWHCSA-N |
| XLogP | -1.95 |
| TPSA | 362.38 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.45 |
| LogP ≤ 5 | -1.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|