C15H14ClN3 — CID 118466453
2-(3-chlorophenyl)-1-ethylpyrrolo[3,2-b]pyridin-5-amine (PubChem CID 118466453) has the molecular formula C15H14ClN3 and a molecular weight of 271.75 g/mol. Its IUPAC name is 2-(3-chlorophenyl)-1-ethylpyrrolo[3,2-b]pyridin-5-amine.
| Compound Name | 2-(3-chlorophenyl)-1-ethylpyrrolo[3,2-b]pyridin-5-amine |
|---|---|
| PubChem CID | 118466453 |
| Molecular Formula | C15H14ClN3 |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 2-(3-chlorophenyl)-1-ethylpyrrolo[3,2-b]pyridin-5-amine |
| SMILES | CCn1c(-c2cccc(Cl)c2)cc2nc(N)ccc21 |
| InChI | InChI=1S/C15H14ClN3/c1-2-19-13-6-7-15(17)18-12(13)9-14(19)10-4-3-5-11(16)8-10/h3-9H,2H2,1H3,(H2,17,18) |
| InChIKey | XEOQFGZVIQXFLO-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |