C13H17N5O2 — CID 118467475
1,3-dimethyl-8-prop-2-enyl-4-(prop-2-enylamino)purine-2,6-dione (PubChem CID 118467475) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is 1,3-dimethyl-8-prop-2-enyl-4-(prop-2-enylamino)purine-2,6-dione.
| Compound Name | 1,3-dimethyl-8-prop-2-enyl-4-(prop-2-enylamino)purine-2,6-dione |
|---|---|
| PubChem CID | 118467475 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | 1,3-dimethyl-8-prop-2-enyl-4-(prop-2-enylamino)purine-2,6-dione |
| SMILES | C=CCNC12N=C(CC=C)N=C1C(=O)N(C)C(=O)N2C |
| InChI | InChI=1S/C13H17N5O2/c1-5-7-9-15-10-11(19)17(3)12(20)18(4)13(10,16-9)14-8-6-2/h5-6,14H,1-2,7-8H2,3-4H3 |
| InChIKey | RZROFQWKBBVTCI-UHFFFAOYSA-N |
| XLogP | 0.37 |
| TPSA | 77.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|