C20H21IN4O3 — CID 118468965
tert-butyl 2-(5-iodo-4-oxo-3-phenylpyrrolo[2,1-f][1,2,4]triazin-2-yl)azetidine-1-carboxylate (PubChem CID 118468965) has the molecular formula C20H21IN4O3 and a molecular weight of 492.32 g/mol. Its IUPAC name is tert-butyl 2-(5-iodo-4-oxo-3-phenylpyrrolo[2,1-f][1,2,4]triazin-2-yl)azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-(5-iodo-4-oxo-3-phenylpyrrolo[2,1-f][1,2,4]triazin-2-yl)azetidine-1-carboxylate |
|---|---|
| PubChem CID | 118468965 |
| Molecular Formula | C20H21IN4O3 |
| Molecular Weight | 492.32 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | tert-butyl 2-(5-iodo-4-oxo-3-phenylpyrrolo[2,1-f][1,2,4]triazin-2-yl)azetidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC1c1nn2ccc(I)c2c(=O)n1-c1ccccc1 |
| InChI | InChI=1S/C20H21IN4O3/c1-20(2,3)28-19(27)23-11-10-15(23)17-22-24-12-9-14(21)16(24)18(26)25(17)13-7-5-4-6-8-13/h4-9,12,15H,10-11H2,1-3H3 |
| InChIKey | KMXXNKFYGPOZPJ-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.32 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|