C20H25NO6S — CID 118469206
ethyl 3-[3-(4-but-2-ynoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanoate (PubChem CID 118469206) has the molecular formula C20H25NO6S and a molecular weight of 407.49 g/mol. Its IUPAC name is ethyl 3-[3-(4-but-2-ynoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanoate.
| Compound Name | ethyl 3-[3-(4-but-2-ynoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanoate |
|---|---|
| PubChem CID | 118469206 |
| Molecular Formula | C20H25NO6S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.14 |
| IUPAC Name | ethyl 3-[3-(4-but-2-ynoxyphenyl)-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanoate |
| SMILES | CC#CCOc1ccc(C2=NOC(CC(C)(C(=O)OCC)S(C)(=O)=O)C2)cc1 |
| InChI | InChI=1S/C20H25NO6S/c1-5-7-12-26-16-10-8-15(9-11-16)18-13-17(27-21-18)14-20(3,28(4,23)24)19(22)25-6-2/h8-11,17H,6,12-14H2,1-4H3 |
| InChIKey | FQDVREKBJCJRAF-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 91.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|