C27H34BNO7S — CID 140770184
benzyl (2R)-2-methyl-2-methylsulfonyl-3-[(5R)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanoate (PubChem CID 140770184) has the molecular formula C27H34BNO7S and a molecular weight of 527.45 g/mol. Its IUPAC name is benzyl (2R)-2-methyl-2-methylsulfonyl-3-[(5R)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanoate.
| Compound Name | benzyl (2R)-2-methyl-2-methylsulfonyl-3-[(5R)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanoate |
|---|---|
| PubChem CID | 140770184 |
| Molecular Formula | C27H34BNO7S |
| Molecular Weight | 527.45 g/mol |
| Exact Mass | 527.21 |
| IUPAC Name | benzyl (2R)-2-methyl-2-methylsulfonyl-3-[(5R)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]propanoate |
| SMILES | CC1(C)OB(c2ccc(C3=NO[C@@H](C[C@](C)(C(=O)OCc4ccccc4)S(C)(=O)=O)C3)cc2)OC1(C)C |
| InChI | InChI=1S/C27H34BNO7S/c1-25(2)26(3,4)36-28(35-25)21-14-12-20(13-15-21)23-16-22(34-29-23)17-27(5,37(6,31)32)24(30)33-18-19-10-8-7-9-11-19/h7-15,22H,16-18H2,1-6H3/t22-,27-/m1/s1 |
| InChIKey | HJDIVZZWLLFNPQ-AJTFRIOCSA-N |
| XLogP | 3.42 |
| TPSA | 100.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|