C22H32BNO8S — CID 123601799
ethyl 2-methyl-2-methylsulfonyl-3-[2-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazolidin-5-yl]propanoate (PubChem CID 123601799) has the molecular formula C22H32BNO8S and a molecular weight of 481.38 g/mol. Its IUPAC name is ethyl 2-methyl-2-methylsulfonyl-3-[2-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazolidin-5-yl]propanoate.
| Compound Name | ethyl 2-methyl-2-methylsulfonyl-3-[2-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazolidin-5-yl]propanoate |
|---|---|
| PubChem CID | 123601799 |
| Molecular Formula | C22H32BNO8S |
| Molecular Weight | 481.38 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | ethyl 2-methyl-2-methylsulfonyl-3-[2-oxo-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-oxazolidin-5-yl]propanoate |
| SMILES | CCOC(=O)C(C)(CC1CN(c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)C(=O)O1)S(C)(=O)=O |
| InChI | InChI=1S/C22H32BNO8S/c1-8-29-18(25)22(6,33(7,27)28)13-17-14-24(19(26)30-17)16-11-9-15(10-12-16)23-31-20(2,3)21(4,5)32-23/h9-12,17H,8,13-14H2,1-7H3 |
| InChIKey | NOQWJQMYIFWJIB-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 108.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.38 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|