C16H22N2O7S — CID 118051026
(2R)-N-hydroxy-3-[(5S)-3-[4-(methoxymethyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanamide (PubChem CID 118051026) has the molecular formula C16H22N2O7S and a molecular weight of 386.43 g/mol. Its IUPAC name is (2R)-N-hydroxy-3-[(5S)-3-[4-(methoxymethyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | (2R)-N-hydroxy-3-[(5S)-3-[4-(methoxymethyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 118051026 |
| Molecular Formula | C16H22N2O7S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | (2R)-N-hydroxy-3-[(5S)-3-[4-(methoxymethyl)phenyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanamide |
| SMILES | COCc1ccc(N2C[C@H](C[C@](C)(C(=O)NO)S(C)(=O)=O)OC2=O)cc1 |
| InChI | InChI=1S/C16H22N2O7S/c1-16(14(19)17-21,26(3,22)23)8-13-9-18(15(20)25-13)12-6-4-11(5-7-12)10-24-2/h4-7,13,21H,8-10H2,1-3H3,(H,17,19)/t13-,16+/m0/s1 |
| InChIKey | JBBHSIFFUFDHKX-XJKSGUPXSA-N |
| XLogP | 0.86 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|