C19H20F2N2O6S — CID 123633355
3-[3-[4-[2-(2,2-difluorocyclopropyl)ethynyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide (PubChem CID 123633355) has the molecular formula C19H20F2N2O6S and a molecular weight of 442.44 g/mol. Its IUPAC name is 3-[3-[4-[2-(2,2-difluorocyclopropyl)ethynyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | 3-[3-[4-[2-(2,2-difluorocyclopropyl)ethynyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 123633355 |
| Molecular Formula | C19H20F2N2O6S |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | 3-[3-[4-[2-(2,2-difluorocyclopropyl)ethynyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC(CC1CN(c2ccc(C#CC3CC3(F)F)cc2)C(=O)O1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C19H20F2N2O6S/c1-18(16(24)22-26,30(2,27)28)10-15-11-23(17(25)29-15)14-7-4-12(5-8-14)3-6-13-9-19(13,20)21/h4-5,7-8,13,15,26H,9-11H2,1-2H3,(H,22,24) |
| InChIKey | UMQDFLRKZNROCM-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|