C21H25N5O6S — CID 118050410
(2R)-N-hydroxy-2-methyl-2-methylsulfonyl-3-[(5S)-2-oxo-3-[4-[5-(triazol-2-yl)pent-1-ynyl]phenyl]-1,3-oxazolidin-5-yl]propanamide (PubChem CID 118050410) has the molecular formula C21H25N5O6S and a molecular weight of 475.53 g/mol. Its IUPAC name is (2R)-N-hydroxy-2-methyl-2-methylsulfonyl-3-[(5S)-2-oxo-3-[4-[5-(triazol-2-yl)pent-1-ynyl]phenyl]-1,3-oxazolidin-5-yl]propanamide.
| Compound Name | (2R)-N-hydroxy-2-methyl-2-methylsulfonyl-3-[(5S)-2-oxo-3-[4-[5-(triazol-2-yl)pent-1-ynyl]phenyl]-1,3-oxazolidin-5-yl]propanamide |
|---|---|
| PubChem CID | 118050410 |
| Molecular Formula | C21H25N5O6S |
| Molecular Weight | 475.53 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | (2R)-N-hydroxy-2-methyl-2-methylsulfonyl-3-[(5S)-2-oxo-3-[4-[5-(triazol-2-yl)pent-1-ynyl]phenyl]-1,3-oxazolidin-5-yl]propanamide |
| SMILES | C[C@@](C[C@H]1CN(c2ccc(C#CCCCn3nccn3)cc2)C(=O)O1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C21H25N5O6S/c1-21(19(27)24-29,33(2,30)31)14-18-15-25(20(28)32-18)17-9-7-16(8-10-17)6-4-3-5-13-26-22-11-12-23-26/h7-12,18,29H,3,5,13-15H2,1-2H3,(H,24,27)/t18-,21+/m0/s1 |
| InChIKey | LRHYMNDQVXGCNB-GHTZIAJQSA-N |
| XLogP | 1.13 |
| TPSA | 143.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.53 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|