C18H22N2O7S — CID 118051005
3-[3-(4-but-2-ynoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide (PubChem CID 118051005) has the molecular formula C18H22N2O7S and a molecular weight of 410.45 g/mol. Its IUPAC name is 3-[3-(4-but-2-ynoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | 3-[3-(4-but-2-ynoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 118051005 |
| Molecular Formula | C18H22N2O7S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | 3-[3-(4-but-2-ynoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC#CCOc1ccc(N2CC(CC(C)(C(=O)NO)S(C)(=O)=O)OC2=O)cc1 |
| InChI | InChI=1S/C18H22N2O7S/c1-4-5-10-26-14-8-6-13(7-9-14)20-12-15(27-17(20)22)11-18(2,16(21)19-23)28(3,24)25/h6-9,15,23H,10-12H2,1-3H3,(H,19,21) |
| InChIKey | RYOVJWPPQFXTIQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 122.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|