C18H21NO7S — CID 118050858
3-[3-(4-but-2-ynoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanoic acid (PubChem CID 118050858) has the molecular formula C18H21NO7S and a molecular weight of 395.43 g/mol. Its IUPAC name is 3-[3-(4-but-2-ynoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanoic acid.
| Compound Name | 3-[3-(4-but-2-ynoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanoic acid |
|---|---|
| PubChem CID | 118050858 |
| Molecular Formula | C18H21NO7S |
| Molecular Weight | 395.43 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | 3-[3-(4-but-2-ynoxyphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanoic acid |
| SMILES | CC#CCOc1ccc(N2CC(CC(C)(C(=O)O)S(C)(=O)=O)OC2=O)cc1 |
| InChI | InChI=1S/C18H21NO7S/c1-4-5-10-25-14-8-6-13(7-9-14)19-12-15(26-17(19)22)11-18(2,16(20)21)27(3,23)24/h6-9,15H,10-12H2,1-3H3,(H,20,21) |
| InChIKey | YRYNVQYMRIZKRU-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 110.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.43 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|