C18H21NO6S — CID 144840869
ethyl (2R)-3-[(5S)-3-(4-ethynylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanoate (PubChem CID 144840869) has the molecular formula C18H21NO6S and a molecular weight of 379.43 g/mol. Its IUPAC name is ethyl (2R)-3-[(5S)-3-(4-ethynylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanoate.
| Compound Name | ethyl (2R)-3-[(5S)-3-(4-ethynylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanoate |
|---|---|
| PubChem CID | 144840869 |
| Molecular Formula | C18H21NO6S |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.11 |
| IUPAC Name | ethyl (2R)-3-[(5S)-3-(4-ethynylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonylpropanoate |
| SMILES | C#Cc1ccc(N2C[C@H](C[C@](C)(C(=O)OCC)S(C)(=O)=O)OC2=O)cc1 |
| InChI | InChI=1S/C18H21NO6S/c1-5-13-7-9-14(10-8-13)19-12-15(25-17(19)21)11-18(3,26(4,22)23)16(20)24-6-2/h1,7-10,15H,6,11-12H2,2-4H3/t15-,18+/m0/s1 |
| InChIKey | XQGUWDPIPJNJQA-MAUKXSAKSA-N |
| XLogP | 1.75 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|