C19H21FN2O6S — CID 118050897
3-[3-[4-(2-cyclopropylethynyl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide (PubChem CID 118050897) has the molecular formula C19H21FN2O6S and a molecular weight of 424.45 g/mol. Its IUPAC name is 3-[3-[4-(2-cyclopropylethynyl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | 3-[3-[4-(2-cyclopropylethynyl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 118050897 |
| Molecular Formula | C19H21FN2O6S |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.11 |
| IUPAC Name | 3-[3-[4-(2-cyclopropylethynyl)-3-fluorophenyl]-2-oxo-1,3-oxazolidin-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC(CC1CN(c2ccc(C#CC3CC3)c(F)c2)C(=O)O1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C19H21FN2O6S/c1-19(17(23)21-25,29(2,26)27)10-15-11-22(18(24)28-15)14-8-7-13(16(20)9-14)6-5-12-3-4-12/h7-9,12,15,25H,3-4,10-11H2,1-2H3,(H,21,23) |
| InChIKey | AYTGCTKTNJXJHT-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|