C22H27FN2O7S — CID 118050757
(2R)-3-[3-(3-fluoro-4-prop-1-ynylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide (PubChem CID 118050757) has the molecular formula C22H27FN2O7S and a molecular weight of 482.53 g/mol. Its IUPAC name is (2R)-3-[3-(3-fluoro-4-prop-1-ynylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide.
| Compound Name | (2R)-3-[3-(3-fluoro-4-prop-1-ynylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide |
|---|---|
| PubChem CID | 118050757 |
| Molecular Formula | C22H27FN2O7S |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | (2R)-3-[3-(3-fluoro-4-prop-1-ynylphenyl)-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide |
| SMILES | CC#Cc1ccc(N2CC(C[C@](C)(C(=O)NOC3CCCCO3)S(C)(=O)=O)OC2=O)cc1F |
| InChI | InChI=1S/C22H27FN2O7S/c1-4-7-15-9-10-16(12-18(15)23)25-14-17(31-21(25)27)13-22(2,33(3,28)29)20(26)24-32-19-8-5-6-11-30-19/h9-10,12,17,19H,5-6,8,11,13-14H2,1-3H3,(H,24,26)/t17?,19?,22-/m1/s1 |
| InChIKey | KAAOZVYNKNBCBU-RKOYOZNISA-N |
| XLogP | 2.29 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|