C26H34N2O8S — CID 118050937
(2R)-3-[3-[4-[2-(3-hydroxy-3-methylcyclobutyl)ethynyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide (PubChem CID 118050937) has the molecular formula C26H34N2O8S and a molecular weight of 534.63 g/mol. Its IUPAC name is (2R)-3-[3-[4-[2-(3-hydroxy-3-methylcyclobutyl)ethynyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide.
| Compound Name | (2R)-3-[3-[4-[2-(3-hydroxy-3-methylcyclobutyl)ethynyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide |
|---|---|
| PubChem CID | 118050937 |
| Molecular Formula | C26H34N2O8S |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.20 |
| IUPAC Name | (2R)-3-[3-[4-[2-(3-hydroxy-3-methylcyclobutyl)ethynyl]phenyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide |
| SMILES | CC1(O)CC(C#Cc2ccc(N3CC(C[C@](C)(C(=O)NOC4CCCCO4)S(C)(=O)=O)OC3=O)cc2)C1 |
| InChI | InChI=1S/C26H34N2O8S/c1-25(31)14-19(15-25)8-7-18-9-11-20(12-10-18)28-17-21(35-24(28)30)16-26(2,37(3,32)33)23(29)27-36-22-6-4-5-13-34-22/h9-12,19,21-22,31H,4-6,13-17H2,1-3H3,(H,27,29)/t19?,21?,22?,25?,26-/m1/s1 |
| InChIKey | KFGYHYQNGDMKPO-JDFGXCSBSA-N |
| XLogP | 2.29 |
| TPSA | 131.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|