C23H30N2O7S — CID 118469187
3-[3-[4-(4-hydroxybut-1-ynyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide (PubChem CID 118469187) has the molecular formula C23H30N2O7S and a molecular weight of 478.57 g/mol. Its IUPAC name is 3-[3-[4-(4-hydroxybut-1-ynyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide.
| Compound Name | 3-[3-[4-(4-hydroxybut-1-ynyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide |
|---|---|
| PubChem CID | 118469187 |
| Molecular Formula | C23H30N2O7S |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | 3-[3-[4-(4-hydroxybut-1-ynyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonyl-N-(oxan-2-yloxy)propanamide |
| SMILES | CC(CC1CC(c2ccc(C#CCCO)cc2)=NO1)(C(=O)NOC1CCCCO1)S(C)(=O)=O |
| InChI | InChI=1S/C23H30N2O7S/c1-23(33(2,28)29,22(27)25-32-21-8-4-6-14-30-21)16-19-15-20(24-31-19)18-11-9-17(10-12-18)7-3-5-13-26/h9-12,19,21,26H,4-6,8,13-16H2,1-2H3,(H,25,27) |
| InChIKey | FYJXWNKHBZNVHT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 123.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|