C22H26N2O6S — CID 118478506
(2R)-N-hydroxy-3-[(5R)-3-[4-[4-[(1R)-1-hydroxyethyl]phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanamide (PubChem CID 118478506) has the molecular formula C22H26N2O6S and a molecular weight of 446.53 g/mol. Its IUPAC name is (2R)-N-hydroxy-3-[(5R)-3-[4-[4-[(1R)-1-hydroxyethyl]phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | (2R)-N-hydroxy-3-[(5R)-3-[4-[4-[(1R)-1-hydroxyethyl]phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 118478506 |
| Molecular Formula | C22H26N2O6S |
| Molecular Weight | 446.53 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (2R)-N-hydroxy-3-[(5R)-3-[4-[4-[(1R)-1-hydroxyethyl]phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanamide |
| SMILES | C[C@@H](O)c1ccc(-c2ccc(C3=NO[C@@H](C[C@](C)(C(=O)NO)S(C)(=O)=O)C3)cc2)cc1 |
| InChI | InChI=1S/C22H26N2O6S/c1-14(25)15-4-6-16(7-5-15)17-8-10-18(11-9-17)20-12-19(30-24-20)13-22(2,21(26)23-27)31(3,28)29/h4-11,14,19,25,27H,12-13H2,1-3H3,(H,23,26)/t14-,19-,22-/m1/s1 |
| InChIKey | CXTCJEFFDFWAFF-JSVDNDDVSA-N |
| XLogP | 2.60 |
| TPSA | 125.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.53 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|