C24H30N2O7S — CID 118469241
N-hydroxy-3-[3-[4-[4-(3-hydroxy-2-methoxypropyl)phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanamide (PubChem CID 118469241) has the molecular formula C24H30N2O7S and a molecular weight of 490.58 g/mol. Its IUPAC name is N-hydroxy-3-[3-[4-[4-(3-hydroxy-2-methoxypropyl)phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | N-hydroxy-3-[3-[4-[4-(3-hydroxy-2-methoxypropyl)phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 118469241 |
| Molecular Formula | C24H30N2O7S |
| Molecular Weight | 490.58 g/mol |
| Exact Mass | 490.18 |
| IUPAC Name | N-hydroxy-3-[3-[4-[4-(3-hydroxy-2-methoxypropyl)phenyl]phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-2-methyl-2-methylsulfonylpropanamide |
| SMILES | COC(CO)Cc1ccc(-c2ccc(C3=NOC(CC(C)(C(=O)NO)S(C)(=O)=O)C3)cc2)cc1 |
| InChI | InChI=1S/C24H30N2O7S/c1-24(23(28)25-29,34(3,30)31)14-20-13-22(26-33-20)19-10-8-18(9-11-19)17-6-4-16(5-7-17)12-21(15-27)32-2/h4-11,20-21,27,29H,12-15H2,1-3H3,(H,25,28) |
| InChIKey | NHLLQGOJGNPJLC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.58 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|