C22H22FN3O5S — CID 123295195
3-[3-[4-[4-(cyanomethyl)phenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide (PubChem CID 123295195) has the molecular formula C22H22FN3O5S and a molecular weight of 459.50 g/mol. Its IUPAC name is 3-[3-[4-[4-(cyanomethyl)phenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | 3-[3-[4-[4-(cyanomethyl)phenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 123295195 |
| Molecular Formula | C22H22FN3O5S |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | 3-[3-[4-[4-(cyanomethyl)phenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC(CC1CC(c2ccc(-c3ccc(CC#N)cc3)c(F)c2)=NO1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C22H22FN3O5S/c1-22(21(27)25-28,32(2,29)30)13-17-12-20(26-31-17)16-7-8-18(19(23)11-16)15-5-3-14(4-6-15)9-10-24/h3-8,11,17,28H,9,12-13H2,1-2H3,(H,25,27) |
| InChIKey | CQTBJEHJKUEQBB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|