C23H24FN3O5S — CID 129274703
(2R)-4-[(5S)-3-[4-[4-(cyanomethyl)phenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide (PubChem CID 129274703) has the molecular formula C23H24FN3O5S and a molecular weight of 473.53 g/mol. Its IUPAC name is (2R)-4-[(5S)-3-[4-[4-(cyanomethyl)phenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide.
| Compound Name | (2R)-4-[(5S)-3-[4-[4-(cyanomethyl)phenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
|---|---|
| PubChem CID | 129274703 |
| Molecular Formula | C23H24FN3O5S |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.14 |
| IUPAC Name | (2R)-4-[(5S)-3-[4-[4-(cyanomethyl)phenyl]-3-fluorophenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylbutanamide |
| SMILES | C[C@@](CC[C@H]1CC(c2ccc(-c3ccc(CC#N)cc3)c(F)c2)=NO1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C23H24FN3O5S/c1-23(22(28)26-29,33(2,30)31)11-9-18-14-21(27-32-18)17-7-8-19(20(24)13-17)16-5-3-15(4-6-16)10-12-25/h3-8,13,18,29H,9-11,14H2,1-2H3,(H,26,28)/t18-,23+/m0/s1 |
| InChIKey | VTGQOGQQPXGFDP-FDDCHVKYSA-N |
| XLogP | 3.14 |
| TPSA | 128.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|