C19H20FN3O5S — CID 118469179
3-[3-[4-(3-fluoro-4-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide (PubChem CID 118469179) has the molecular formula C19H20FN3O5S and a molecular weight of 421.45 g/mol. Its IUPAC name is 3-[3-[4-(3-fluoro-4-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide.
| Compound Name | 3-[3-[4-(3-fluoro-4-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 118469179 |
| Molecular Formula | C19H20FN3O5S |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 3-[3-[4-(3-fluoro-4-pyridinyl)phenyl]-4,5-dihydro-1,2-oxazol-5-yl]-N-hydroxy-2-methyl-2-methylsulfonylpropanamide |
| SMILES | CC(CC1CC(c2ccc(-c3ccncc3F)cc2)=NO1)(C(=O)NO)S(C)(=O)=O |
| InChI | InChI=1S/C19H20FN3O5S/c1-19(18(24)22-25,29(2,26)27)10-14-9-17(23-28-14)13-5-3-12(4-6-13)15-7-8-21-11-16(15)20/h3-8,11,14,25H,9-10H2,1-2H3,(H,22,24) |
| InChIKey | UNCSNHQTQIVJIB-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 117.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|