C18H23N3O6S — CID 118050389
N-hydroxy-2-methyl-3-[3-[5-(3-methylbut-1-ynyl)-2-pyridinyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methylsulfonylpropanamide (PubChem CID 118050389) has the molecular formula C18H23N3O6S and a molecular weight of 409.46 g/mol. Its IUPAC name is N-hydroxy-2-methyl-3-[3-[5-(3-methylbut-1-ynyl)-2-pyridinyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methylsulfonylpropanamide.
| Compound Name | N-hydroxy-2-methyl-3-[3-[5-(3-methylbut-1-ynyl)-2-pyridinyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methylsulfonylpropanamide |
|---|---|
| PubChem CID | 118050389 |
| Molecular Formula | C18H23N3O6S |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-hydroxy-2-methyl-3-[3-[5-(3-methylbut-1-ynyl)-2-pyridinyl]-2-oxo-1,3-oxazolidin-5-yl]-2-methylsulfonylpropanamide |
| SMILES | CC(C)C#Cc1ccc(N2CC(CC(C)(C(=O)NO)S(C)(=O)=O)OC2=O)nc1 |
| InChI | InChI=1S/C18H23N3O6S/c1-12(2)5-6-13-7-8-15(19-10-13)21-11-14(27-17(21)23)9-18(3,16(22)20-24)28(4,25)26/h7-8,10,12,14,24H,9,11H2,1-4H3,(H,20,22) |
| InChIKey | PRJMSBNZBQKHIQ-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|