C26H42O5 — CID 118474357
5-[(3aS,5R,6R,6aS)-5-(2,2-dimethylpropanoyloxy)-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid (PubChem CID 118474357) has the molecular formula C26H42O5 and a molecular weight of 434.62 g/mol. Its IUPAC name is 5-[(3aS,5R,6R,6aS)-5-(2,2-dimethylpropanoyloxy)-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid.
| Compound Name | 5-[(3aS,5R,6R,6aS)-5-(2,2-dimethylpropanoyloxy)-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 118474357 |
| Molecular Formula | C26H42O5 |
| Molecular Weight | 434.62 g/mol |
| Exact Mass | 434.30 |
| IUPAC Name | 5-[(3aS,5R,6R,6aS)-5-(2,2-dimethylpropanoyloxy)-6-[(E,3S)-3-hydroxyoct-1-enyl]-1,3a,4,5,6,6a-hexahydropentalen-2-yl]pentanoic acid |
| SMILES | CCCCC[C@H](O)/C=C/[C@@H]1[C@H]2CC(CCCCC(=O)O)=C[C@H]2C[C@H]1OC(=O)C(C)(C)C |
| InChI | InChI=1S/C26H42O5/c1-5-6-7-11-20(27)13-14-21-22-16-18(10-8-9-12-24(28)29)15-19(22)17-23(21)31-25(30)26(2,3)4/h13-15,19-23,27H,5-12,16-17H2,1-4H3,(H,28,29)/b14-13+/t19-,20-,21+,22-,23+/m0/s1 |
| InChIKey | DSQXIOLOOJNMBS-DWQYKQQASA-N |
| XLogP | 5.67 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.62 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|