C42H61N5O18 — CID 11847760
2-[bis[2-[carboxymethyl-[2-oxo-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylamino)ethyl]amino]ethyl]amino]acetic acid (PubChem CID 11847760) has the molecular formula C42H61N5O18 and a molecular weight of 923.97 g/mol. Its IUPAC name is 2-[bis[2-[carboxymethyl-[2-oxo-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylamino)ethyl]amino]ethyl]amino]acetic acid.
| Compound Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylamino)ethyl]amino]ethyl]amino]acetic acid |
|---|---|
| PubChem CID | 11847760 |
| Molecular Formula | C42H61N5O18 |
| Molecular Weight | 923.97 g/mol |
| Exact Mass | 923.40 |
| IUPAC Name | 2-[bis[2-[carboxymethyl-[2-oxo-2-(2,5,8,11,14-pentaoxabicyclo[13.4.0]nonadeca-1(15),16,18-trien-17-ylamino)ethyl]amino]ethyl]amino]acetic acid |
| SMILES | O=C(O)CN(CCN(CC(=O)O)CC(=O)Nc1ccc2c(c1)OCCOCCOCCOCCO2)CCN(CC(=O)O)CC(=O)Nc1ccc2c(c1)OCCOCCOCCOCCO2 |
| InChI | InChI=1S/C42H61N5O18/c48-38(43-32-1-3-34-36(25-32)64-23-19-60-15-11-56-9-13-58-17-21-62-34)27-46(30-41(52)53)7-5-45(29-40(50)51)6-8-47(31-42(54)55)28-39(49)44-33-2-4-35-37(26-33)65-24-20-61-16-12-57-10-14-59-18-22-63-35/h1-4,25-26H,5-24,27-31H2,(H,43,48)(H,44,49)(H,50,51)(H,52,53)(H,54,55) |
| InChIKey | VKZRGIBDDOQJAC-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 272.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 65 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 923.97 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 18 |