C12H10N6O2 — CID 118481445
methyl 3-[(4-amino-6-cyano-1,3,5-triazin-2-yl)amino]benzoate (PubChem CID 118481445) has the molecular formula C12H10N6O2 and a molecular weight of 270.25 g/mol. Its IUPAC name is methyl 3-[(4-amino-6-cyano-1,3,5-triazin-2-yl)amino]benzoate.
| Compound Name | methyl 3-[(4-amino-6-cyano-1,3,5-triazin-2-yl)amino]benzoate |
|---|---|
| PubChem CID | 118481445 |
| Molecular Formula | C12H10N6O2 |
| Molecular Weight | 270.25 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | methyl 3-[(4-amino-6-cyano-1,3,5-triazin-2-yl)amino]benzoate |
| SMILES | COC(=O)c1cccc(Nc2nc(N)nc(C#N)n2)c1 |
| InChI | InChI=1S/C12H10N6O2/c1-20-10(19)7-3-2-4-8(5-7)15-12-17-9(6-13)16-11(14)18-12/h2-5H,1H3,(H3,14,15,16,17,18) |
| InChIKey | QWKAEQNTTGNDIW-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 126.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |