About (4-propylthietan-2-yl) acetate
(4-propylthietan-2-yl) acetate (PubChem CID 118481871) has the molecular formula C8H14O2S
and a molecular weight of 174.26 g/mol. Its IUPAC name is (4-propylthietan-2-yl) acetate.
Molecular Properties
| Compound Name | (4-propylthietan-2-yl) acetate |
| PubChem CID | 118481871 |
| Molecular Formula | C8H14O2S |
| Molecular Weight | 174.26 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | (4-propylthietan-2-yl) acetate |
| SMILES | CCCC1CC(OC(C)=O)S1 |
| InChI | InChI=1S/C8H14O2S/c1-3-4-7-5-8(11-7)10-6(2)9/h7-8H,3-5H2,1-2H3 |
| InChIKey | GLAITLZKKVMCAL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.26 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-propylthietan-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-propylthietan-2-yl) acetate?
The IUPAC name of (4-propylthietan-2-yl) acetate (CID 118481871) is (4-propylthietan-2-yl) acetate.
What is the SMILES notation for (4-propylthietan-2-yl) acetate?
The canonical SMILES for (4-propylthietan-2-yl) acetate is CCCC1CC(OC(C)=O)S1.
What is the InChIKey of (4-propylthietan-2-yl) acetate?
The InChIKey is GLAITLZKKVMCAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2S/c1-3-4-7-5-8(11-7)10-6(2)9/h7-8H,3-5H2,1-2H3.
What are the key properties of (4-propylthietan-2-yl) acetate?
(4-propylthietan-2-yl) acetate has a molecular weight of 174.26 g/mol, XLogP of 2.18, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-propylthietan-2-yl) acetate is sourced from PubChem (CID 118481871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).