C9H11F3O3 — CID 118483004
2-methyl-5-(2,2,4-trifluorooxetan-3-yl)oxypent-1-en-3-one (PubChem CID 118483004) has the molecular formula C9H11F3O3 and a molecular weight of 224.18 g/mol. Its IUPAC name is 2-methyl-5-(2,2,4-trifluorooxetan-3-yl)oxypent-1-en-3-one.
| Compound Name | 2-methyl-5-(2,2,4-trifluorooxetan-3-yl)oxypent-1-en-3-one |
|---|---|
| PubChem CID | 118483004 |
| Molecular Formula | C9H11F3O3 |
| Molecular Weight | 224.18 g/mol |
| Exact Mass | 224.07 |
| IUPAC Name | 2-methyl-5-(2,2,4-trifluorooxetan-3-yl)oxypent-1-en-3-one |
| SMILES | C=C(C)C(=O)CCOC1C(F)OC1(F)F |
| InChI | InChI=1S/C9H11F3O3/c1-5(2)6(13)3-4-14-7-8(10)15-9(7,11)12/h7-8H,1,3-4H2,2H3 |
| InChIKey | JKDHYCXKPMKIOJ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.18 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|